CAS 65370-42-5 appears in our catalog under these names: 4-Chloro-2-nitropyridine, 4-Chloro-2-nitropyridine 97%, 4-Chloro-2-nitropyridine, 97%, 97%, 4-Chloro-2-nitropyridine, 98%. Offered by: Chemat, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 500g.
4-chloro-2-nitropyridine (CAS 65370-42-5) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 4-chloro-2-nitropyridine. InChIKey: YPKBJRKFGYVURL-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 4-chloro-2-nitropyridine |
| InChIKey | YPKBJRKFGYVURL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)