Products 65372-09-0

CAS 65372-09-0 is the registry number for Rosuvastatin Impurity 183. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(furan-2-yl)acetate (CAS 65372-09-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: tert-butyl 2-(furan-2-yl)acetate. InChIKey: NMWDNCBIPLPTEH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O3
Molecular weight182.22 g/mol
IUPAC nametert-butyl 2-(furan-2-yl)acetate
InChIKeyNMWDNCBIPLPTEH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC1=CC=CO1

Computed by PubChem (NCBI)