CAS 65399-17-9 appears in our catalog under these names: 5-(Methoxycarbonyl)-2-methylbenzoic acid, 5-(Methoxycarbonyl)-2-Methylbenzoic Acid, 98%, 98%, 5-(Methoxycarbonyl)-2-methylbenzoic acid, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 500mg, 250mg, 100mg, 1g, 5g.
5-methoxycarbonyl-2-methylbenzoic acid (CAS 65399-17-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 5-methoxycarbonyl-2-methylbenzoic acid. InChIKey: RDMBGNNRUNYSOP-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 5-methoxycarbonyl-2-methylbenzoic acid |
| InChIKey | RDMBGNNRUNYSOP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)