CAS 654-15-9 is the registry number for 3-Benzotriazol-1-yl-propionic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-(benzotriazol-1-yl)propanoic acid (CAS 654-15-9) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 3-(benzotriazol-1-yl)propanoic acid. InChIKey: NZNPMUUOXMZCBF-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 3-(benzotriazol-1-yl)propanoic acid |
| InChIKey | NZNPMUUOXMZCBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2CCC(=O)O |
Computed by PubChem (NCBI)