Products 65487-73-2
CAS 65487-73-2 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-5-ethoxy-5-oxopentanoic acid, 99%(HPLC),RG, 99%(HPLC),RG. Offered by: Chemat. Available pack sizes: 5g, 25g.
(2S)-5-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 65487-73-2) is a chemical compound with the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. IUPAC name: (2S)-5-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: OZWIELRLNJLCDQ-QMMMGPOBSA-N.
| Molecular formula | C12H21NO6 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (2S)-5-ethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | OZWIELRLNJLCDQ-QMMMGPOBSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)