Products 655253-58-0

CAS 655253-58-0 is the registry number for 1-Methyl-4-phenyl-1h-imidazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-methyl-5-phenylimidazole-4-carboxylic acid (CAS 655253-58-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-methyl-5-phenylimidazole-4-carboxylic acid. InChIKey: RPJKZONANHLFTE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O2
Molecular weight202.21 g/mol
IUPAC name3-methyl-5-phenylimidazole-4-carboxylic acid
InChIKeyRPJKZONANHLFTE-UHFFFAOYSA-N
SMILESCN1C=NC(=C1C(=O)O)C2=CC=CC=C2

Computed by PubChem (NCBI)