CAS 655255-06-4 appears in our catalog under these names: 3–((tert–butoxycarbonyl)amino)furan–2–carboxylic acid, 3-((tert-Butoxycarbonyl)amino)furan-2-carboxylic acid, 3-((tert-Butoxycarbonyl)amino)furan-2-carboxylic acid, 97%, 97%, 3-((tert-Butoxycarbonyl)amino)furan-2-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.
3-[(2-methylpropan-2-yl)oxycarbonylamino]furan-2-carboxylic acid (CAS 655255-06-4) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]furan-2-carboxylic acid. InChIKey: NBZNSNPSQJFTQF-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]furan-2-carboxylic acid |
| InChIKey | NBZNSNPSQJFTQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(OC=C1)C(=O)O |
Computed by PubChem (NCBI)