Products 65550-80-3

CAS 65550-80-3 appears in our catalog under these names: 2-Bromo-5-iodonicotinic acid 95%, 2-Bromo-5-iodonicotinic acid, 95%, 95%, 2-BROMO-5-IODONICOTINIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-bromo-5-iodopyridine-3-carboxylic acid (CAS 65550-80-3) is a chemical compound with the molecular formula C6H3BrINO2 and a molecular weight of 327.90 g/mol. IUPAC name: 2-bromo-5-iodopyridine-3-carboxylic acid. InChIKey: QLWYFTRYOMPMRB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrINO2
Molecular weight327.90 g/mol
IUPAC name2-bromo-5-iodopyridine-3-carboxylic acid
InChIKeyQLWYFTRYOMPMRB-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1C(=O)O)Br)I

Computed by PubChem (NCBI)