Products 65566-65-6
CAS 65566-65-6 appears in our catalog under these names: 4-Hydroxyantipyrine-d3, D3-4-Hydroxyantipyrine. Offered by: MedChemExpress, HPC Standards. Available pack sizes: 1mg, 5mg, 1x10mg.
4-hydroxy-5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one (CAS 65566-65-6) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 207.24 g/mol. IUPAC name: 4-hydroxy-5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one. InChIKey: SKVPTPMWXJSBTF-BMSJAHLVSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 207.24 g/mol |
| IUPAC name | 4-hydroxy-5-methyl-2-phenyl-1-(trideuteriomethyl)pyrazol-3-one |
| InChIKey | SKVPTPMWXJSBTF-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=C(C(=O)N1C2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)