CAS 65609-28-1 appears in our catalog under these names: N-(1,3-Benzodioxol-5-ylmethyl)urea, 95%, N-(1,3-Benzodioxol-5-ylmethyl)urea. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
1,3-benzodioxol-5-ylmethylurea (CAS 65609-28-1) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 1,3-benzodioxol-5-ylmethylurea. InChIKey: HDXQGGUSJKXTNQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 1,3-benzodioxol-5-ylmethylurea |
| InChIKey | HDXQGGUSJKXTNQ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)N |
Computed by PubChem (NCBI)