Products 65613-27-6

CAS 65613-27-6 appears in our catalog under these names: 3,5-Dimethylthiophene-2-carboxylic acid, 98%, 3,5-Dimethylthiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 100mg.

Structural formula: {0} (CAS {1})

3,5-dimethylthiophene-2-carboxylic acid (CAS 65613-27-6) is a chemical compound with the molecular formula C7H8O2S and a molecular weight of 156.20 g/mol. IUPAC name: 3,5-dimethylthiophene-2-carboxylic acid. InChIKey: QGQBKGYXFUDGDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O2S
Molecular weight156.20 g/mol
IUPAC name3,5-dimethylthiophene-2-carboxylic acid
InChIKeyQGQBKGYXFUDGDQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(S1)C(=O)O)C

Computed by PubChem (NCBI)