CAS 656239-36-0 is the registry number for Propan-2-yl 6-fluoropyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Propan-2-yl 6-fluoropyridine-2-carboxylate (CAS 656239-36-0) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: propan-2-yl 6-fluoropyridine-2-carboxylate. InChIKey: QDQZNQGEYULIKI-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | propan-2-yl 6-fluoropyridine-2-carboxylate |
| InChIKey | QDQZNQGEYULIKI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=NC(=CC=C1)F |
Computed by PubChem (NCBI)