CAS 65678-11-7 appears in our catalog under these names: 3-(tert-Butyl)-4-hydroxybenzaldehyde 95%, 3-(Tert-butyl)-4-hydroxybenzaldehyde, 97%, 97%, 3-(tert-Butyl)-4-hydroxybenzaldehyde, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
3-tert-butyl-4-hydroxybenzaldehyde (CAS 65678-11-7) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 3-tert-butyl-4-hydroxybenzaldehyde. InChIKey: IBZZAKITZYDOFP-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-tert-butyl-4-hydroxybenzaldehyde |
| InChIKey | IBZZAKITZYDOFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C=O)O |
Computed by PubChem (NCBI)