Products 656798-50-4
CAS 656798-50-4 appears in our catalog under these names: 4-Amino-3-nitrophenylacetylene, 98%, 4-Ethynyl-2-nitroaniline, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-ethynyl-2-nitroaniline (CAS 656798-50-4) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-ethynyl-2-nitroaniline. InChIKey: ZYKXXTRGRCOWJO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-ethynyl-2-nitroaniline |
| InChIKey | ZYKXXTRGRCOWJO-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)