CAS 656836-87-2 appears in our catalog under these names: 2,4-Dichlorobenzo(d)oxazole, 97%, 2,4-Dichlorobenzo[d]oxazole, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
2,4-dichloro-1,3-benzoxazole (CAS 656836-87-2) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 2,4-dichloro-1,3-benzoxazole. InChIKey: NFTDVHFDIIDIGD-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,4-dichloro-1,3-benzoxazole |
| InChIKey | NFTDVHFDIIDIGD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(O2)Cl |
Computed by PubChem (NCBI)