CAS 65731-83-1 appears in our catalog under these names: (1R,2R,1'R)-Cypermethrin, Cypermethrin Impurity 15. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 200mg.
Trans-[(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 65731-83-1) is a chemical compound with the molecular formula C22H19Cl2NO3 and a molecular weight of 416.3 g/mol. IUPAC name: trans-[(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: KAATUXNTWXVJKI-BJLQDIEVSA-N.
| Molecular formula | C22H19Cl2NO3 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | trans-[(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | KAATUXNTWXVJKI-BJLQDIEVSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)O[C@@H](C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)