CAS 66841-24-5 appears in our catalog under these names: Beta-cypermethrin, 95%, Cypermethrin Impurity 11, (1R,2S,1'R)-Cypermethrin. Offered by: Combi-blocks, Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 1g, 250mg, 100mg, 10mg, 25mg, 50mg, 200mg, on request.
Cis-[(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 66841-24-5) is a chemical compound with the molecular formula C22H19Cl2NO3 and a molecular weight of 416.3 g/mol. IUPAC name: cis-[(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: KAATUXNTWXVJKI-HBFSDRIKSA-N.
| Molecular formula | C22H19Cl2NO3 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | cis-[(R)-cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | KAATUXNTWXVJKI-HBFSDRIKSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)O[C@@H](C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)