CAS 82523-65-7 appears in our catalog under these names: trans-Cypermethrin-d6, trans-Cypermethrin D6 (dimethyl D6), trans-Cypermethrin D6 (dimethyl D6) 100 µg/mL in Acetone, trans-Cypermethrin D6 (dimethyl D6) 100 µg/mL in Cyclohexane, D6-trans-Cypermethrin, Concentration: 100 µg/ml Solvent: Ethyl acetate. Offered by: Chemat Brand, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 10mg, 1ml, 1x1ml.
[cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylate (CAS 82523-65-7) is a chemical compound with the molecular formula C22H19Cl2NO3 and a molecular weight of 422.3 g/mol. IUPAC name: [cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylate. InChIKey: KAATUXNTWXVJKI-WFGJKAKNSA-N.
| Molecular formula | C22H19Cl2NO3 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | [cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylate |
| InChIKey | KAATUXNTWXVJKI-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)