Products 65854-71-9
CAS 65854-71-9 appears in our catalog under these names: 2-Acetamido-5-chlorobenzophenone-d5, 2–Acetamido–5–chlorobenzophenone–d5. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 25mg, 5mg.
N-[4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]acetamide (CAS 65854-71-9) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 278.74 g/mol. IUPAC name: N-[4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]acetamide. InChIKey: NHAUKYAYIYDFST-VIQYUKPQSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 278.74 g/mol |
| IUPAC name | N-[4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]acetamide |
| InChIKey | NHAUKYAYIYDFST-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=C(C=CC(=C2)Cl)NC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)