Products 65854-73-1
CAS 65854-73-1 is the registry number for 2-Amino-5-chlorobenzophenone Oxime-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 50 mg, 25 mg, 10 mg.
(NZ)-N-[(2-amino-5-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methylidene]hydroxylamine (CAS 65854-73-1) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 251.72 g/mol. IUPAC name: (NZ)-N-[(2-amino-5-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methylidene]hydroxylamine. InChIKey: GCAVNCINXJNLED-JHFBGYRKSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 251.72 g/mol |
| IUPAC name | (NZ)-N-[(2-amino-5-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methylidene]hydroxylamine |
| InChIKey | GCAVNCINXJNLED-JHFBGYRKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=N/O)/C2=C(C=CC(=C2)Cl)N)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-5-chlorobenzophenone Oxime-d5