CAS 65877-60-3 is the registry number for 1,2,4,6-Tetra-O-acetyl-a-D-mannopyranose. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg.
[(2R,3S,4S,5S,6R)-3,5,6-triacetyloxy-4-hydroxyoxan-2-yl]methyl acetate (CAS 65877-60-3) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3S,4S,5S,6R)-3,5,6-triacetyloxy-4-hydroxyoxan-2-yl]methyl acetate. InChIKey: VEXTUPCIMUQWAO-BJJPWKGXSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3S,4S,5S,6R)-3,5,6-triacetyloxy-4-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | VEXTUPCIMUQWAO-BJJPWKGXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)O)OC(=O)C |
Computed by PubChem (NCBI)