Products 65877-60-3

CAS 65877-60-3 is the registry number for 1,2,4,6-Tetra-O-acetyl-a-D-mannopyranose. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg.

Structural formula: {0} (CAS {1})

[(2R,3S,4S,5S,6R)-3,5,6-triacetyloxy-4-hydroxyoxan-2-yl]methyl acetate (CAS 65877-60-3) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3S,4S,5S,6R)-3,5,6-triacetyloxy-4-hydroxyoxan-2-yl]methyl acetate. InChIKey: VEXTUPCIMUQWAO-BJJPWKGXSA-N.

Identity
Molecular formulaC14H20O10
Molecular weight348.30 g/mol
IUPAC name[(2R,3S,4S,5S,6R)-3,5,6-triacetyloxy-4-hydroxyoxan-2-yl]methyl acetate
InChIKeyVEXTUPCIMUQWAO-BJJPWKGXSA-N
SMILESCC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)O)OC(=O)C

Computed by PubChem (NCBI)