Products 65882-39-5
CAS 65882-39-5 appears in our catalog under these names: 7–methyl DMT, 7-Methyl DMT. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 5 mg, 1 mg.
N,N-dimethyl-2-(7-methyl-1H-indol-3-yl)ethanamine (CAS 65882-39-5) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: N,N-dimethyl-2-(7-methyl-1H-indol-3-yl)ethanamine. InChIKey: PQSFTUCFMWBITK-UHFFFAOYSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | N,N-dimethyl-2-(7-methyl-1H-indol-3-yl)ethanamine |
| InChIKey | PQSFTUCFMWBITK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)CCN(C)C |
Computed by PubChem (NCBI)