CAS 65948-16-5 is the registry number for 4,4,4-Trifluoro-3-phenylbutan-1-ol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4,4,4-trifluoro-3-phenylbutan-1-ol (CAS 65948-16-5) is a chemical compound with the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. IUPAC name: 4,4,4-trifluoro-3-phenylbutan-1-ol. InChIKey: PHGDLNUUBPOOAV-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-phenylbutan-1-ol |
| InChIKey | PHGDLNUUBPOOAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCO)C(F)(F)F |
Computed by PubChem (NCBI)