Products 65967-73-9
CAS 65967-73-9 is the registry number for Sydonic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-4-(2-hydroxy-6-methylheptan-2-yl)benzoic acid (CAS 65967-73-9) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: 3-hydroxy-4-(2-hydroxy-6-methylheptan-2-yl)benzoic acid. InChIKey: VZXPWVDKXCYHSI-UHFFFAOYSA-N.
| Molecular formula | C15H22O4 |
|---|---|
| Molecular weight | 266.33 g/mol |
| IUPAC name | 3-hydroxy-4-(2-hydroxy-6-methylheptan-2-yl)benzoic acid |
| InChIKey | VZXPWVDKXCYHSI-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)(C1=C(C=C(C=C1)C(=O)O)O)O |
Computed by PubChem (NCBI)