CAS 65971-76-8 appears in our catalog under these names: 6-Amino-2-bromo-3-chlorobenzoic acid, 95%, 6–Amino–2–bromo–3–chlorobenzoic acid, 6-Amino-2-bromo-3-chlorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
6-amino-2-bromo-3-chlorobenzoic acid (CAS 65971-76-8) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 6-amino-2-bromo-3-chlorobenzoic acid. InChIKey: PXHYZQUJCFJBRY-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 6-amino-2-bromo-3-chlorobenzoic acid |
| InChIKey | PXHYZQUJCFJBRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)