Products 66034-51-3
CAS 66034-51-3 appears in our catalog under these names: D–Glucose–1，2，3，4，5，6，6–D7, D–Glucose–d7, D-Glucose-d7, 99.44%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 25 mg, 50 mg.
(2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentahydroxyhexan-1-one (CAS 66034-51-3) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 187.20 g/mol. IUPAC name: (2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentahydroxyhexan-1-one. InChIKey: GZCGUPFRVQAUEE-JKMJYBEYSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | (2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentahydroxyhexan-1-one |
| InChIKey | GZCGUPFRVQAUEE-JKMJYBEYSA-N |
| SMILES | [2H]C(=O)[C@@]([2H])([C@]([2H])([C@@]([2H])([C@@]([2H])(C([2H])([2H])O)O)O)O)O |
Computed by PubChem (NCBI)