Products 66067-43-4
CAS 66067-43-4 appears in our catalog under these names: 3-Ethylbenzophenone, 3-Ethylbenzophenone, >95% (HPLC), (3–ethylphenyl)(phenyl)methanone, 3-Ethylbenzophenone 95%, 3-Ethylbenzophenone, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 250mg, 25mg, 100mg, 1g, 5g, 25g, 10g.
(3-ethylphenyl)-phenylmethanone (CAS 66067-43-4) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: (3-ethylphenyl)-phenylmethanone. InChIKey: FVSYHKJWZIKKDM-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (3-ethylphenyl)-phenylmethanone |
| InChIKey | FVSYHKJWZIKKDM-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)