CAS 66192-02-7 appears in our catalog under these names: 3-(2-Bromo-5-methoxyphenyl)propanoic acid, 95-<97%, 3-(2-Bromo-5-methoxyphenyl)propanoic acid, 95%, 95%, 3-(2-BROMO-5-METHOXYPHENYL)PROPANOIC ACID, 98%, 3-(2-Bromo-5-methoxyphenyl)propanoic acid, 95%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg, 1g.
3-(2-bromo-5-methoxyphenyl)propanoic acid (CAS 66192-02-7) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-(2-bromo-5-methoxyphenyl)propanoic acid. InChIKey: PRQBOENPLKPYNI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-(2-bromo-5-methoxyphenyl)propanoic acid |
| InChIKey | PRQBOENPLKPYNI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)CCC(=O)O |
Computed by PubChem (NCBI)