CAS 66335-32-8 is the registry number for 2-Chloro-1-methyl-1H-indole-3,5-dicarbaldehyde. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-chloro-1-methylindole-3,5-dicarbaldehyde (CAS 66335-32-8) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 2-chloro-1-methylindole-3,5-dicarbaldehyde. InChIKey: DZHRMXYXRVSNFD-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 2-chloro-1-methylindole-3,5-dicarbaldehyde |
| InChIKey | DZHRMXYXRVSNFD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)C(=C1Cl)C=O |
Computed by PubChem (NCBI)