CAS 6636-02-8 appears in our catalog under these names: 2,2-Diphenylacetohydrazide, 95%, 2,2-Diphenylacetohydrazide 95%, 2,2-Diphenylacetohydrazide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
2,2-diphenylacetohydrazide (CAS 6636-02-8) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 2,2-diphenylacetohydrazide. InChIKey: YBBSKAGTEPBSNK-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2,2-diphenylacetohydrazide |
| InChIKey | YBBSKAGTEPBSNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)