Products 6636-22-2
CAS 6636-22-2 appears in our catalog under these names: (S)-3-(4-Acetoxyphenyl)-2-aminopropanoic acid, 97%, O-Acetyl-l-tyrosine, 95%, O-Acetyl-L-tyrosine, >95% (HPLC), O–Acetyl–L–tyrosine, O-Acetyl-L-tyrosine, 97%, 97%. Offered by: Fluorochem, Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 500mg, 100mg.
(2S)-3-(4-acetyloxyphenyl)-2-aminopropanoic acid (CAS 6636-22-2) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2S)-3-(4-acetyloxyphenyl)-2-aminopropanoic acid. InChIKey: QBFQXAKABOKEHT-JTQLQIEISA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2S)-3-(4-acetyloxyphenyl)-2-aminopropanoic acid |
| InChIKey | QBFQXAKABOKEHT-JTQLQIEISA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)