CAS 6637-22-5 appears in our catalog under these names: 6-Methoxy-2,3-dimethylquinoxaline, 95-<97%, 6-Methoxy-2,3-dimethylquinoxaline, 97%, 6-Methoxy-2,3-dimethylquinoxaline, 98%, 98%, 6-Methoxy-2,3-dimethylquinoxaline, 98%. Offered by: Hoffman Fine Chemicals, AmBeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 250mg, 50mg, 100mg.
6-methoxy-2,3-dimethylquinoxaline (CAS 6637-22-5) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 6-methoxy-2,3-dimethylquinoxaline. InChIKey: QWGMPWRVGQLNHK-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 6-methoxy-2,3-dimethylquinoxaline |
| InChIKey | QWGMPWRVGQLNHK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=C(C=CC2=N1)OC)C |
Computed by PubChem (NCBI)