Products 6649-26-9
CAS 6649-26-9 appears in our catalog under these names: 4-Hydroxy-tetramisole, >95% (HPLC), Tetramisole-4-hydroxy, 4-Hydroxy-tetramisole. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1mg, 2,5mg, 10mg, 1x10mg.
4-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenol (CAS 6649-26-9) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 4-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenol. InChIKey: QBEDXUHDXKEDES-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 4-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenol |
| InChIKey | QBEDXUHDXKEDES-UHFFFAOYSA-N |
| SMILES | C1CSC2=NC(CN21)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)