Products 664997-23-3
CAS 664997-23-3 is the registry number for 2-(1H-Pyrrol-1-yl)-5-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-pyrrol-1-yl-5-(trifluoromethyl)aniline (CAS 664997-23-3) is a chemical compound with the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. IUPAC name: 2-pyrrol-1-yl-5-(trifluoromethyl)aniline. InChIKey: BTLPAJJJYDQMKE-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 2-pyrrol-1-yl-5-(trifluoromethyl)aniline |
| InChIKey | BTLPAJJJYDQMKE-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)