Products 66512-38-7

CAS 66512-38-7 is the registry number for Etomidate Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-[formyl-[(1S)-1-phenylethyl]amino]acetate (CAS 66512-38-7) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: ethyl 2-[formyl-[(1S)-1-phenylethyl]amino]acetate. InChIKey: WFDXDCVMMSACQE-NSHDSACASA-N.

Identity
Molecular formulaC13H17NO3
Molecular weight235.28 g/mol
IUPAC nameethyl 2-[formyl-[(1S)-1-phenylethyl]amino]acetate
InChIKeyWFDXDCVMMSACQE-NSHDSACASA-N
SMILESCCOC(=O)CN(C=O)[C@@H](C)C1=CC=CC=C1

Computed by PubChem (NCBI)