CAS 66512-38-7 is the registry number for Etomidate Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[formyl-[(1S)-1-phenylethyl]amino]acetate (CAS 66512-38-7) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: ethyl 2-[formyl-[(1S)-1-phenylethyl]amino]acetate. InChIKey: WFDXDCVMMSACQE-NSHDSACASA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | ethyl 2-[formyl-[(1S)-1-phenylethyl]amino]acetate |
| InChIKey | WFDXDCVMMSACQE-NSHDSACASA-N |
| SMILES | CCOC(=O)CN(C=O)[C@@H](C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)