CAS 66537-42-6 is the registry number for Longifolenaldehyde. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
(1R,2S,7S,8R,9R)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane-8-carbaldehyde (CAS 66537-42-6) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1R,2S,7S,8R,9R)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane-8-carbaldehyde. InChIKey: PBMHTGOFWRRJFS-PFFFPCNUSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1R,2S,7S,8R,9R)-3,3,7-trimethyltricyclo[5.4.0.02,9]undecane-8-carbaldehyde |
| InChIKey | PBMHTGOFWRRJFS-PFFFPCNUSA-N |
| SMILES | C[C@]12CCCC([C@@H]3[C@H]1CC[C@H]3[C@H]2C=O)(C)C |
Computed by PubChem (NCBI)