Products 66553-30-8
CAS 66553-30-8 is the registry number for 2,4-Dimethylbenzoic anhydride, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2,4-dimethylbenzoyl) 2,4-dimethylbenzoate (CAS 66553-30-8) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: (2,4-dimethylbenzoyl) 2,4-dimethylbenzoate. InChIKey: IBTNAKFCXDQGMP-UHFFFAOYSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | (2,4-dimethylbenzoyl) 2,4-dimethylbenzoate |
| InChIKey | IBTNAKFCXDQGMP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OC(=O)C2=C(C=C(C=C2)C)C)C |
Computed by PubChem (NCBI)