CAS 6665-95-8 is the registry number for 2,3-Dimethyl-6-nitrophenol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dimethyl-6-nitrophenol (CAS 6665-95-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,3-dimethyl-6-nitrophenol. InChIKey: KXWOAPZXQJGYPU-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,3-dimethyl-6-nitrophenol |
| InChIKey | KXWOAPZXQJGYPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])O)C |
Computed by PubChem (NCBI)