Products 66670-54-0

CAS 66670-54-0 is the registry number for 6-Chloro-2h-chromene-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 6-chloro-2H-chromene-3-carboxylate (CAS 66670-54-0) is a chemical compound with the molecular formula C12H11ClO3 and a molecular weight of 238.66 g/mol. IUPAC name: ethyl 6-chloro-2H-chromene-3-carboxylate. InChIKey: GROZIKGJLUCJFB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClO3
Molecular weight238.66 g/mol
IUPAC nameethyl 6-chloro-2H-chromene-3-carboxylate
InChIKeyGROZIKGJLUCJFB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=CC(=C2)Cl)OC1

Computed by PubChem (NCBI)