CAS 67593-46-8 appears in our catalog under these names: Methyl 2-acetyl-3-(2-chlorophenyl)acrylate, 95%, Amlodipine Impurity 76. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, 25g, on request.
Methyl (2E)-2-[(2-chlorophenyl)methylidene]-3-oxobutanoate (CAS 67593-46-8) is a chemical compound with the molecular formula C12H11ClO3 and a molecular weight of 238.66 g/mol. IUPAC name: methyl (2E)-2-[(2-chlorophenyl)methylidene]-3-oxobutanoate. InChIKey: MNMKWCPLHQYQLU-JXMROGBWSA-N.
| Molecular formula | C12H11ClO3 |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | methyl (2E)-2-[(2-chlorophenyl)methylidene]-3-oxobutanoate |
| InChIKey | MNMKWCPLHQYQLU-JXMROGBWSA-N |
| SMILES | CC(=O)/C(=C\C1=CC=CC=C1Cl)/C(=O)OC |
Computed by PubChem (NCBI)