CAS 882248-22-8 is the registry number for (5-Chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid (CAS 882248-22-8) is a chemical compound with the molecular formula C12H11ClO3 and a molecular weight of 238.66 g/mol. IUPAC name: 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid. InChIKey: WDYKMPBNUTVXOM-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO3 |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)acetic acid |
| InChIKey | WDYKMPBNUTVXOM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1Cl)C)C(=CO2)CC(=O)O |
Computed by PubChem (NCBI)