CAS 666729-57-3 is the registry number for TGF-βRI inhibitor 3, 99.16%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg.
1-[2-(6,7-dimethoxyquinolin-4-yl)oxy-4,5-dimethylphenyl]ethanone (CAS 666729-57-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 1-[2-(6,7-dimethoxyquinolin-4-yl)oxy-4,5-dimethylphenyl]ethanone. InChIKey: AAUXGXRHLYYHSO-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 1-[2-(6,7-dimethoxyquinolin-4-yl)oxy-4,5-dimethylphenyl]ethanone |
| InChIKey | AAUXGXRHLYYHSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)OC2=C3C=C(C(=CC3=NC=C2)OC)OC)C(=O)C |
Computed by PubChem (NCBI)