CAS 66735-25-9 appears in our catalog under these names: 2,6-Dimethylquinolin-4-amine (hydrochloride), 98%, 2,6-Dimethylquinolin-4-amine hydrochloride, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
2,6-dimethylquinolin-4-amine;hydrochloride (CAS 66735-25-9) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 2,6-dimethylquinolin-4-amine;hydrochloride. InChIKey: IVJZTJDGXHRBSA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 2,6-dimethylquinolin-4-amine;hydrochloride |
| InChIKey | IVJZTJDGXHRBSA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(N=C2C=C1)C)N.Cl |
Computed by PubChem (NCBI)