CAS 667414-05-3 appears in our catalog under these names: 2-(2,3-Dihydro-1h-inden-5-yloxy)-2-methylpropanoic acid, 95%, 2-((2,3-Dihydro-1H-inden-5-yl)oxy)-2-methylpropanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,3-dihydro-1H-inden-5-yloxy)-2-methylpropanoic acid (CAS 667414-05-3) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-5-yloxy)-2-methylpropanoic acid. InChIKey: UKOIJAUCGQUMDV-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-5-yloxy)-2-methylpropanoic acid |
| InChIKey | UKOIJAUCGQUMDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC2=C(CCC2)C=C1 |
Computed by PubChem (NCBI)