CAS 66778-16-3 is the registry number for 2-(Cyclohexylthio)-6-nitro-1,3-benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-cyclohexylsulfanyl-6-nitro-1,3-benzothiazole (CAS 66778-16-3) is a chemical compound with the molecular formula C13H14N2O2S2 and a molecular weight of 294.4 g/mol. IUPAC name: 2-cyclohexylsulfanyl-6-nitro-1,3-benzothiazole. InChIKey: QJLZIEQKECXJDF-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2S2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 2-cyclohexylsulfanyl-6-nitro-1,3-benzothiazole |
| InChIKey | QJLZIEQKECXJDF-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)SC2=NC3=C(S2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)