CAS 954564-58-0 appears in our catalog under these names: 3-(6,7-Dihydrothieno[3,2-c]pyridin-5(4h)-ylsulfonyl)aniline, 95%, 3-{4H,5H,6H,7H-thieno(3,2-c)pyridine-5-sulfonyl}aniline, 95%, 3-{4H,5H,6H,7H-Thieno(3,2-c)pyridine-5-sulfonyl}aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline (CAS 954564-58-0) is a chemical compound with the molecular formula C13H14N2O2S2 and a molecular weight of 294.4 g/mol. IUPAC name: 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline. InChIKey: QWWGDLBYALBPBT-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2S2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline |
| InChIKey | QWWGDLBYALBPBT-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)S(=O)(=O)C3=CC=CC(=C3)N |
Computed by PubChem (NCBI)