CAS 68728-03-0 is the registry number for 2-Acetylthiophene p-toluenesulfonylhydrazone, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
4-methyl-N-[(E)-1-thiophen-2-ylethylideneamino]benzenesulfonamide (CAS 68728-03-0) is a chemical compound with the molecular formula C13H14N2O2S2 and a molecular weight of 294.4 g/mol. IUPAC name: 4-methyl-N-[(E)-1-thiophen-2-ylethylideneamino]benzenesulfonamide. InChIKey: QYIGWVSKOVPXJX-SDNWHVSQSA-N.
| Molecular formula | C13H14N2O2S2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-1-thiophen-2-ylethylideneamino]benzenesulfonamide |
| InChIKey | QYIGWVSKOVPXJX-SDNWHVSQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C(\C)/C2=CC=CS2 |
Computed by PubChem (NCBI)