Products 667871-49-0

CAS 667871-49-0 is the registry number for 1,3-Diethyl 2-(2-(2-methoxyethoxy)ethyl)propanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[2-(2-methoxyethoxy)ethyl]propanedioate (CAS 667871-49-0) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: diethyl 2-[2-(2-methoxyethoxy)ethyl]propanedioate. InChIKey: KQUKAMFBDQKRHG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22O6
Molecular weight262.30 g/mol
IUPAC namediethyl 2-[2-(2-methoxyethoxy)ethyl]propanedioate
InChIKeyKQUKAMFBDQKRHG-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCOCCOC)C(=O)OCC

Computed by PubChem (NCBI)