CAS 66888-79-7 appears in our catalog under these names: [1,1'-Biphenyl]-3,3'-diyldimethanol, 95%, (1,1'–Biphenyl)–3,3'–diyldimethanol, [1,1'-Biphenyl]-3,3'-diyldimethanol, 97%, 97%, [1,1'-BIPHENYL]-3,3'-DIYLDIMETHANOL, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
[3-[3-(hydroxymethyl)phenyl]phenyl]methanol (CAS 66888-79-7) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: [3-[3-(hydroxymethyl)phenyl]phenyl]methanol. InChIKey: VEOUUDAQOPKAEX-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | [3-[3-(hydroxymethyl)phenyl]phenyl]methanol |
| InChIKey | VEOUUDAQOPKAEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=CC(=C2)CO)CO |
Computed by PubChem (NCBI)