CAS 66917-06-4 is the registry number for 2-(4-Azidobutyl)isoindoline-1,3-dione. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-azidobutyl)isoindole-1,3-dione (CAS 66917-06-4) is a chemical compound with the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. IUPAC name: 2-(4-azidobutyl)isoindole-1,3-dione. InChIKey: ORKCIOAZJQNDJI-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O2 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 2-(4-azidobutyl)isoindole-1,3-dione |
| InChIKey | ORKCIOAZJQNDJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)